C20H14N6O9 — CID 4111159
2-N,5-N-bis[(2-hydroxy-5-nitrophenyl)methylideneamino]furan-2,5-dicarboxamide (PubChem CID 4111159) has the molecular formula C20H14N6O9 and a molecular weight of 482.37 g/mol. Its IUPAC name is 2-N,5-N-bis[(2-hydroxy-5-nitrophenyl)methylideneamino]furan-2,5-dicarboxamide.
| Compound Name | 2-N,5-N-bis[(2-hydroxy-5-nitrophenyl)methylideneamino]furan-2,5-dicarboxamide |
|---|---|
| PubChem CID | 4111159 |
| Molecular Formula | C20H14N6O9 |
| Molecular Weight | 482.37 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | 2-N,5-N-bis[(2-hydroxy-5-nitrophenyl)methylideneamino]furan-2,5-dicarboxamide |
| SMILES | O=C(NN=Cc1cc([N+](=O)[O-])ccc1O)c1ccc(C(=O)NN=Cc2cc([N+](=O)[O-])ccc2O)o1 |
| InChI | InChI=1S/C20H14N6O9/c27-15-3-1-13(25(31)32)7-11(15)9-21-23-19(29)17-5-6-18(35-17)20(30)24-22-10-12-8-14(26(33)34)2-4-16(12)28/h1-10,27-28H,(H,23,29)(H,24,30) |
| InChIKey | CZFZASWCWRPJSD-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 222.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|