C16H12N6O7 — CID 135533634
N-[(Z)-(2-hydroxy-5-nitrophenyl)methylideneamino]-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide (PubChem CID 135533634) has the molecular formula C16H12N6O7 and a molecular weight of 400.31 g/mol. Its IUPAC name is N-[(Z)-(2-hydroxy-5-nitrophenyl)methylideneamino]-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide.
| Compound Name | N-[(Z)-(2-hydroxy-5-nitrophenyl)methylideneamino]-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 135533634 |
| Molecular Formula | C16H12N6O7 |
| Molecular Weight | 400.31 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | N-[(Z)-(2-hydroxy-5-nitrophenyl)methylideneamino]-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide |
| SMILES | O=C(N/N=C\c1cc([N+](=O)[O-])ccc1O)c1ccc(Cn2cc([N+](=O)[O-])cn2)o1 |
| InChI | InChI=1S/C16H12N6O7/c23-14-3-1-11(21(25)26)5-10(14)6-17-19-16(24)15-4-2-13(29-15)9-20-8-12(7-18-20)22(27)28/h1-8,23H,9H2,(H,19,24)/b17-6- |
| InChIKey | PQPABXQGXMFUSH-FMQZQXMHSA-N |
| XLogP | 1.81 |
| TPSA | 178.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|