C15H14FN7O4 — CID 124849162
N-[(Z)-(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide (PubChem CID 124849162) has the molecular formula C15H14FN7O4 and a molecular weight of 375.32 g/mol. Its IUPAC name is N-[(Z)-(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide.
| Compound Name | N-[(Z)-(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 124849162 |
| Molecular Formula | C15H14FN7O4 |
| Molecular Weight | 375.32 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | N-[(Z)-(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide |
| SMILES | CCn1ncc(/C=N\NC(=O)c2ccc(Cn3cc([N+](=O)[O-])cn3)o2)c1F |
| InChI | InChI=1S/C15H14FN7O4/c1-2-22-14(16)10(6-19-22)5-17-20-15(24)13-4-3-12(27-13)9-21-8-11(7-18-21)23(25)26/h3-8H,2,9H2,1H3,(H,20,24)/b17-5- |
| InChIKey | OCOYJRTVPDVAGK-ZWSORDCHSA-N |
| XLogP | 1.55 |
| TPSA | 133.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|