C18H16F2N4O6 — CID 19460913
N-[4-(difluoromethoxy)-3-ethoxyphenyl]-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide (PubChem CID 19460913) has the molecular formula C18H16F2N4O6 and a molecular weight of 422.34 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)-3-ethoxyphenyl]-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide.
| Compound Name | N-[4-(difluoromethoxy)-3-ethoxyphenyl]-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19460913 |
| Molecular Formula | C18H16F2N4O6 |
| Molecular Weight | 422.34 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | N-[4-(difluoromethoxy)-3-ethoxyphenyl]-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide |
| SMILES | CCOc1cc(NC(=O)c2ccc(Cn3cc([N+](=O)[O-])cn3)o2)ccc1OC(F)F |
| InChI | InChI=1S/C18H16F2N4O6/c1-2-28-16-7-11(3-5-14(16)30-18(19)20)22-17(25)15-6-4-13(29-15)10-23-9-12(8-21-23)24(26)27/h3-9,18H,2,10H2,1H3,(H,22,25) |
| InChIKey | LYPJTMQZYXMMHN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 121.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|