C23H23F2NO6 — CID 19413402
N-[4-(difluoromethoxy)-3-ethoxyphenyl]-5-[(4-ethoxyphenoxy)methyl]furan-2-carboxamide (PubChem CID 19413402) has the molecular formula C23H23F2NO6 and a molecular weight of 447.43 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)-3-ethoxyphenyl]-5-[(4-ethoxyphenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[4-(difluoromethoxy)-3-ethoxyphenyl]-5-[(4-ethoxyphenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19413402 |
| Molecular Formula | C23H23F2NO6 |
| Molecular Weight | 447.43 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | N-[4-(difluoromethoxy)-3-ethoxyphenyl]-5-[(4-ethoxyphenoxy)methyl]furan-2-carboxamide |
| SMILES | CCOc1ccc(OCc2ccc(C(=O)Nc3ccc(OC(F)F)c(OCC)c3)o2)cc1 |
| InChI | InChI=1S/C23H23F2NO6/c1-3-28-16-6-8-17(9-7-16)30-14-18-10-12-20(31-18)22(27)26-15-5-11-19(32-23(24)25)21(13-15)29-4-2/h5-13,23H,3-4,14H2,1-2H3,(H,26,27) |
| InChIKey | VCRRDDFCWRLSBS-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 79.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.43 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |