C23H25NO4 — CID 19446544
N-(4-ethoxyphenyl)-5-[(4-propan-2-ylphenoxy)methyl]furan-2-carboxamide (PubChem CID 19446544) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-5-[(4-propan-2-ylphenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-(4-ethoxyphenyl)-5-[(4-propan-2-ylphenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19446544 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | N-(4-ethoxyphenyl)-5-[(4-propan-2-ylphenoxy)methyl]furan-2-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2ccc(COc3ccc(C(C)C)cc3)o2)cc1 |
| InChI | InChI=1S/C23H25NO4/c1-4-26-19-11-7-18(8-12-19)24-23(25)22-14-13-21(28-22)15-27-20-9-5-17(6-10-20)16(2)3/h5-14,16H,4,15H2,1-3H3,(H,24,25) |
| InChIKey | XTWJKAXXSLCBAG-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |