C24H27NO3 — CID 19450467
5-[(4-butan-2-ylphenoxy)methyl]-N-(4-ethylphenyl)furan-2-carboxamide (PubChem CID 19450467) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is 5-[(4-butan-2-ylphenoxy)methyl]-N-(4-ethylphenyl)furan-2-carboxamide.
| Compound Name | 5-[(4-butan-2-ylphenoxy)methyl]-N-(4-ethylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19450467 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 5-[(4-butan-2-ylphenoxy)methyl]-N-(4-ethylphenyl)furan-2-carboxamide |
| SMILES | CCc1ccc(NC(=O)c2ccc(COc3ccc(C(C)CC)cc3)o2)cc1 |
| InChI | InChI=1S/C24H27NO3/c1-4-17(3)19-8-12-21(13-9-19)27-16-22-14-15-23(28-22)24(26)25-20-10-6-18(5-2)7-11-20/h6-15,17H,4-5,16H2,1-3H3,(H,25,26) |
| InChIKey | IDNOPDSWQZPWLQ-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |