C19H23NO5 — CID 19450595
methyl 2-[[5-[(4-butan-2-ylphenoxy)methyl]furan-2-carbonyl]amino]acetate (PubChem CID 19450595) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is methyl 2-[[5-[(4-butan-2-ylphenoxy)methyl]furan-2-carbonyl]amino]acetate.
| Compound Name | methyl 2-[[5-[(4-butan-2-ylphenoxy)methyl]furan-2-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 19450595 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | methyl 2-[[5-[(4-butan-2-ylphenoxy)methyl]furan-2-carbonyl]amino]acetate |
| SMILES | CCC(C)c1ccc(OCc2ccc(C(=O)NCC(=O)OC)o2)cc1 |
| InChI | InChI=1S/C19H23NO5/c1-4-13(2)14-5-7-15(8-6-14)24-12-16-9-10-17(25-16)19(22)20-11-18(21)23-3/h5-10,13H,4,11-12H2,1-3H3,(H,20,22) |
| InChIKey | FEIFOHUMFQNRJO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |