C16H18O4 — CID 725859
5-[[4-[(2S)-butan-2-yl]phenoxy]methyl]furan-2-carboxylic acid (PubChem CID 725859) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is 5-[[4-[(2S)-butan-2-yl]phenoxy]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[4-[(2S)-butan-2-yl]phenoxy]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 725859 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 5-[[4-[(2S)-butan-2-yl]phenoxy]methyl]furan-2-carboxylic acid |
| SMILES | CC[C@H](C)c1ccc(OCc2ccc(C(=O)O)o2)cc1 |
| InChI | InChI=1S/C16H18O4/c1-3-11(2)12-4-6-13(7-5-12)19-10-14-8-9-15(20-14)16(17)18/h4-9,11H,3,10H2,1-2H3,(H,17,18)/t11-/m0/s1 |
| InChIKey | FAKSOKPXLBLQNV-NSHDSACASA-N |
| XLogP | 4.07 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |