C22H20Br2N2O5 — CID 19450446
5-[(4-butan-2-ylphenoxy)methyl]-N-(2,6-dibromo-4-nitrophenyl)furan-2-carboxamide (PubChem CID 19450446) has the molecular formula C22H20Br2N2O5 and a molecular weight of 552.22 g/mol. Its IUPAC name is 5-[(4-butan-2-ylphenoxy)methyl]-N-(2,6-dibromo-4-nitrophenyl)furan-2-carboxamide.
| Compound Name | 5-[(4-butan-2-ylphenoxy)methyl]-N-(2,6-dibromo-4-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19450446 |
| Molecular Formula | C22H20Br2N2O5 |
| Molecular Weight | 552.22 g/mol |
| Exact Mass | 549.97 |
| IUPAC Name | 5-[(4-butan-2-ylphenoxy)methyl]-N-(2,6-dibromo-4-nitrophenyl)furan-2-carboxamide |
| SMILES | CCC(C)c1ccc(OCc2ccc(C(=O)Nc3c(Br)cc([N+](=O)[O-])cc3Br)o2)cc1 |
| InChI | InChI=1S/C22H20Br2N2O5/c1-3-13(2)14-4-6-16(7-5-14)30-12-17-8-9-20(31-17)22(27)25-21-18(23)10-15(26(28)29)11-19(21)24/h4-11,13H,3,12H2,1-2H3,(H,25,27) |
| InChIKey | AAVOJMVMVONPHS-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 94.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.22 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|