C27H25N3O6 — CID 19450683
5-[(4-butan-2-ylphenoxy)methyl]-N-(3-nitro-5-pyridin-3-yloxyphenyl)furan-2-carboxamide (PubChem CID 19450683) has the molecular formula C27H25N3O6 and a molecular weight of 487.51 g/mol. Its IUPAC name is 5-[(4-butan-2-ylphenoxy)methyl]-N-(3-nitro-5-pyridin-3-yloxyphenyl)furan-2-carboxamide.
| Compound Name | 5-[(4-butan-2-ylphenoxy)methyl]-N-(3-nitro-5-pyridin-3-yloxyphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19450683 |
| Molecular Formula | C27H25N3O6 |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | 5-[(4-butan-2-ylphenoxy)methyl]-N-(3-nitro-5-pyridin-3-yloxyphenyl)furan-2-carboxamide |
| SMILES | CCC(C)c1ccc(OCc2ccc(C(=O)Nc3cc(Oc4cccnc4)cc([N+](=O)[O-])c3)o2)cc1 |
| InChI | InChI=1S/C27H25N3O6/c1-3-18(2)19-6-8-22(9-7-19)34-17-24-10-11-26(36-24)27(31)29-20-13-21(30(32)33)15-25(14-20)35-23-5-4-12-28-16-23/h4-16,18H,3,17H2,1-2H3,(H,29,31) |
| InChIKey | BBJIZJSQVWKYHO-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|