C24H24F2N2O6 — CID 19450561
5-[(4-butan-2-ylphenoxy)methyl]-N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]furan-2-carboxamide (PubChem CID 19450561) has the molecular formula C24H24F2N2O6 and a molecular weight of 474.46 g/mol. Its IUPAC name is 5-[(4-butan-2-ylphenoxy)methyl]-N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]furan-2-carboxamide.
| Compound Name | 5-[(4-butan-2-ylphenoxy)methyl]-N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19450561 |
| Molecular Formula | C24H24F2N2O6 |
| Molecular Weight | 474.46 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 5-[(4-butan-2-ylphenoxy)methyl]-N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]furan-2-carboxamide |
| SMILES | CCC(C)c1ccc(OCc2ccc(C(=O)Nc3cc(OCC(F)F)cc([N+](=O)[O-])c3)o2)cc1 |
| InChI | InChI=1S/C24H24F2N2O6/c1-3-15(2)16-4-6-19(7-5-16)32-13-20-8-9-22(34-20)24(29)27-17-10-18(28(30)31)12-21(11-17)33-14-23(25)26/h4-12,15,23H,3,13-14H2,1-2H3,(H,27,29) |
| InChIKey | JXUAPHIIJNJMRF-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.46 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|