C27H23ClN2O6 — CID 19448138
N-[3-(4-chlorophenoxy)-5-nitrophenyl]-5-[(4-propan-2-ylphenoxy)methyl]furan-2-carboxamide (PubChem CID 19448138) has the molecular formula C27H23ClN2O6 and a molecular weight of 506.94 g/mol. Its IUPAC name is N-[3-(4-chlorophenoxy)-5-nitrophenyl]-5-[(4-propan-2-ylphenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[3-(4-chlorophenoxy)-5-nitrophenyl]-5-[(4-propan-2-ylphenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19448138 |
| Molecular Formula | C27H23ClN2O6 |
| Molecular Weight | 506.94 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | N-[3-(4-chlorophenoxy)-5-nitrophenyl]-5-[(4-propan-2-ylphenoxy)methyl]furan-2-carboxamide |
| SMILES | CC(C)c1ccc(OCc2ccc(C(=O)Nc3cc(Oc4ccc(Cl)cc4)cc([N+](=O)[O-])c3)o2)cc1 |
| InChI | InChI=1S/C27H23ClN2O6/c1-17(2)18-3-7-22(8-4-18)34-16-24-11-12-26(36-24)27(31)29-20-13-21(30(32)33)15-25(14-20)35-23-9-5-19(28)6-10-23/h3-15,17H,16H2,1-2H3,(H,29,31) |
| InChIKey | HOMJXHKPFSRQEC-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.94 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|