C29H27ClN2O6 — CID 19452574
5-[(4-tert-butylphenoxy)methyl]-N-[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]furan-2-carboxamide (PubChem CID 19452574) has the molecular formula C29H27ClN2O6 and a molecular weight of 535.00 g/mol. Its IUPAC name is 5-[(4-tert-butylphenoxy)methyl]-N-[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]furan-2-carboxamide.
| Compound Name | 5-[(4-tert-butylphenoxy)methyl]-N-[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19452574 |
| Molecular Formula | C29H27ClN2O6 |
| Molecular Weight | 535.00 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | 5-[(4-tert-butylphenoxy)methyl]-N-[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]furan-2-carboxamide |
| SMILES | Cc1cc(Cl)ccc1Oc1cc(NC(=O)c2ccc(COc3ccc(C(C)(C)C)cc3)o2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H27ClN2O6/c1-18-13-20(30)7-11-26(18)38-25-15-21(14-22(16-25)32(34)35)31-28(33)27-12-10-24(37-27)17-36-23-8-5-19(6-9-23)29(2,3)4/h5-16H,17H2,1-4H3,(H,31,33) |
| InChIKey | YXJPEVCBSLRJEL-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.00 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|