C25H19ClN2O6 — CID 19446177
5-[(3-chlorophenoxy)methyl]-N-[3-(4-methylphenoxy)-5-nitrophenyl]furan-2-carboxamide (PubChem CID 19446177) has the molecular formula C25H19ClN2O6 and a molecular weight of 478.89 g/mol. Its IUPAC name is 5-[(3-chlorophenoxy)methyl]-N-[3-(4-methylphenoxy)-5-nitrophenyl]furan-2-carboxamide.
| Compound Name | 5-[(3-chlorophenoxy)methyl]-N-[3-(4-methylphenoxy)-5-nitrophenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19446177 |
| Molecular Formula | C25H19ClN2O6 |
| Molecular Weight | 478.89 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 5-[(3-chlorophenoxy)methyl]-N-[3-(4-methylphenoxy)-5-nitrophenyl]furan-2-carboxamide |
| SMILES | Cc1ccc(Oc2cc(NC(=O)c3ccc(COc4cccc(Cl)c4)o3)cc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C25H19ClN2O6/c1-16-5-7-20(8-6-16)33-23-13-18(12-19(14-23)28(30)31)27-25(29)24-10-9-22(34-24)15-32-21-4-2-3-17(26)11-21/h2-14H,15H2,1H3,(H,27,29) |
| InChIKey | IEVSIDLXMKSAMN-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.89 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|