C26H19ClN2O8 — CID 19449047
methyl 4-[[5-[[3-(4-chlorophenoxy)-5-nitrophenyl]carbamoyl]furan-2-yl]methoxy]benzoate (PubChem CID 19449047) has the molecular formula C26H19ClN2O8 and a molecular weight of 522.90 g/mol. Its IUPAC name is methyl 4-[[5-[[3-(4-chlorophenoxy)-5-nitrophenyl]carbamoyl]furan-2-yl]methoxy]benzoate.
| Compound Name | methyl 4-[[5-[[3-(4-chlorophenoxy)-5-nitrophenyl]carbamoyl]furan-2-yl]methoxy]benzoate |
|---|---|
| PubChem CID | 19449047 |
| Molecular Formula | C26H19ClN2O8 |
| Molecular Weight | 522.90 g/mol |
| Exact Mass | 522.08 |
| IUPAC Name | methyl 4-[[5-[[3-(4-chlorophenoxy)-5-nitrophenyl]carbamoyl]furan-2-yl]methoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCc2ccc(C(=O)Nc3cc(Oc4ccc(Cl)cc4)cc([N+](=O)[O-])c3)o2)cc1 |
| InChI | InChI=1S/C26H19ClN2O8/c1-34-26(31)16-2-6-20(7-3-16)35-15-22-10-11-24(37-22)25(30)28-18-12-19(29(32)33)14-23(13-18)36-21-8-4-17(27)5-9-21/h2-14H,15H2,1H3,(H,28,30) |
| InChIKey | IEZLKDOKGFMZKZ-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 130.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.90 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|