C25H19ClN2O7 — CID 19446179
5-[(3-chlorophenoxy)methyl]-N-[3-(4-methoxyphenoxy)-5-nitrophenyl]furan-2-carboxamide (PubChem CID 19446179) has the molecular formula C25H19ClN2O7 and a molecular weight of 494.89 g/mol. Its IUPAC name is 5-[(3-chlorophenoxy)methyl]-N-[3-(4-methoxyphenoxy)-5-nitrophenyl]furan-2-carboxamide.
| Compound Name | 5-[(3-chlorophenoxy)methyl]-N-[3-(4-methoxyphenoxy)-5-nitrophenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19446179 |
| Molecular Formula | C25H19ClN2O7 |
| Molecular Weight | 494.89 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | 5-[(3-chlorophenoxy)methyl]-N-[3-(4-methoxyphenoxy)-5-nitrophenyl]furan-2-carboxamide |
| SMILES | COc1ccc(Oc2cc(NC(=O)c3ccc(COc4cccc(Cl)c4)o3)cc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C25H19ClN2O7/c1-32-19-5-7-20(8-6-19)34-23-13-17(12-18(14-23)28(30)31)27-25(29)24-10-9-22(35-24)15-33-21-4-2-3-16(26)11-21/h2-14H,15H2,1H3,(H,27,29) |
| InChIKey | DBHMKXKICHJTTP-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 113.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.89 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|