C25H18F2N2O7 — CID 19453214
5-[(2,4-difluorophenoxy)methyl]-N-[3-(4-methoxyphenoxy)-5-nitrophenyl]furan-2-carboxamide (PubChem CID 19453214) has the molecular formula C25H18F2N2O7 and a molecular weight of 496.42 g/mol. Its IUPAC name is 5-[(2,4-difluorophenoxy)methyl]-N-[3-(4-methoxyphenoxy)-5-nitrophenyl]furan-2-carboxamide.
| Compound Name | 5-[(2,4-difluorophenoxy)methyl]-N-[3-(4-methoxyphenoxy)-5-nitrophenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19453214 |
| Molecular Formula | C25H18F2N2O7 |
| Molecular Weight | 496.42 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | 5-[(2,4-difluorophenoxy)methyl]-N-[3-(4-methoxyphenoxy)-5-nitrophenyl]furan-2-carboxamide |
| SMILES | COc1ccc(Oc2cc(NC(=O)c3ccc(COc4ccc(F)cc4F)o3)cc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C25H18F2N2O7/c1-33-18-3-5-19(6-4-18)35-21-12-16(11-17(13-21)29(31)32)28-25(30)24-9-7-20(36-24)14-34-23-8-2-15(26)10-22(23)27/h2-13H,14H2,1H3,(H,28,30) |
| InChIKey | YYJIULGTTJSDDC-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 113.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.42 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|