C19H13F2N3O7 — CID 19453273
5-[(2,4-difluorophenoxy)methyl]-N-(4-methyl-3,5-dinitrophenyl)furan-2-carboxamide (PubChem CID 19453273) has the molecular formula C19H13F2N3O7 and a molecular weight of 433.32 g/mol. Its IUPAC name is 5-[(2,4-difluorophenoxy)methyl]-N-(4-methyl-3,5-dinitrophenyl)furan-2-carboxamide.
| Compound Name | 5-[(2,4-difluorophenoxy)methyl]-N-(4-methyl-3,5-dinitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19453273 |
| Molecular Formula | C19H13F2N3O7 |
| Molecular Weight | 433.32 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | 5-[(2,4-difluorophenoxy)methyl]-N-(4-methyl-3,5-dinitrophenyl)furan-2-carboxamide |
| SMILES | Cc1c([N+](=O)[O-])cc(NC(=O)c2ccc(COc3ccc(F)cc3F)o2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H13F2N3O7/c1-10-15(23(26)27)7-12(8-16(10)24(28)29)22-19(25)18-5-3-13(31-18)9-30-17-4-2-11(20)6-14(17)21/h2-8H,9H2,1H3,(H,22,25) |
| InChIKey | SKUYYAXOLNJRRY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 137.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.32 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|