C19H14F2N4O7 — CID 19484018
4-[(2,4-difluorophenoxy)methyl]-5-methyl-N-(4-methyl-3,5-dinitrophenyl)-1,2-oxazole-3-carboxamide (PubChem CID 19484018) has the molecular formula C19H14F2N4O7 and a molecular weight of 448.34 g/mol. Its IUPAC name is 4-[(2,4-difluorophenoxy)methyl]-5-methyl-N-(4-methyl-3,5-dinitrophenyl)-1,2-oxazole-3-carboxamide.
| Compound Name | 4-[(2,4-difluorophenoxy)methyl]-5-methyl-N-(4-methyl-3,5-dinitrophenyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 19484018 |
| Molecular Formula | C19H14F2N4O7 |
| Molecular Weight | 448.34 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 4-[(2,4-difluorophenoxy)methyl]-5-methyl-N-(4-methyl-3,5-dinitrophenyl)-1,2-oxazole-3-carboxamide |
| SMILES | Cc1onc(C(=O)Nc2cc([N+](=O)[O-])c(C)c([N+](=O)[O-])c2)c1COc1ccc(F)cc1F |
| InChI | InChI=1S/C19H14F2N4O7/c1-9-15(24(27)28)6-12(7-16(9)25(29)30)22-19(26)18-13(10(2)32-23-18)8-31-17-4-3-11(20)5-14(17)21/h3-7H,8H2,1-2H3,(H,22,26) |
| InChIKey | BNJFXYXFULJFQI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 150.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.34 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|