C18H12F2N2O5 — CID 36705158
N-(4-fluoro-3-nitrophenyl)-5-[(4-fluorophenoxy)methyl]furan-2-carboxamide (PubChem CID 36705158) has the molecular formula C18H12F2N2O5 and a molecular weight of 374.30 g/mol. Its IUPAC name is N-(4-fluoro-3-nitrophenyl)-5-[(4-fluorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-(4-fluoro-3-nitrophenyl)-5-[(4-fluorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 36705158 |
| Molecular Formula | C18H12F2N2O5 |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | N-(4-fluoro-3-nitrophenyl)-5-[(4-fluorophenoxy)methyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)c([N+](=O)[O-])c1)c1ccc(COc2ccc(F)cc2)o1 |
| InChI | InChI=1S/C18H12F2N2O5/c19-11-1-4-13(5-2-11)26-10-14-6-8-17(27-14)18(23)21-12-3-7-15(20)16(9-12)22(24)25/h1-9H,10H2,(H,21,23) |
| InChIKey | OBUFJSYLNRFNKS-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 94.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|