C21H19N3O8 — CID 19413374
5-[(4-ethoxyphenoxy)methyl]-N-(4-methyl-3,5-dinitrophenyl)furan-2-carboxamide (PubChem CID 19413374) has the molecular formula C21H19N3O8 and a molecular weight of 441.40 g/mol. Its IUPAC name is 5-[(4-ethoxyphenoxy)methyl]-N-(4-methyl-3,5-dinitrophenyl)furan-2-carboxamide.
| Compound Name | 5-[(4-ethoxyphenoxy)methyl]-N-(4-methyl-3,5-dinitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19413374 |
| Molecular Formula | C21H19N3O8 |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | 5-[(4-ethoxyphenoxy)methyl]-N-(4-methyl-3,5-dinitrophenyl)furan-2-carboxamide |
| SMILES | CCOc1ccc(OCc2ccc(C(=O)Nc3cc([N+](=O)[O-])c(C)c([N+](=O)[O-])c3)o2)cc1 |
| InChI | InChI=1S/C21H19N3O8/c1-3-30-15-4-6-16(7-5-15)31-12-17-8-9-20(32-17)21(25)22-14-10-18(23(26)27)13(2)19(11-14)24(28)29/h4-11H,3,12H2,1-2H3,(H,22,25) |
| InChIKey | LIDLYALEBXTASV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 146.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|