C20H14F4N2O6 — CID 19457263
N-(4-ethoxy-2-nitrophenyl)-5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19457263) has the molecular formula C20H14F4N2O6 and a molecular weight of 454.33 g/mol. Its IUPAC name is N-(4-ethoxy-2-nitrophenyl)-5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-(4-ethoxy-2-nitrophenyl)-5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19457263 |
| Molecular Formula | C20H14F4N2O6 |
| Molecular Weight | 454.33 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | N-(4-ethoxy-2-nitrophenyl)-5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2ccc(COc3c(F)c(F)cc(F)c3F)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H14F4N2O6/c1-2-30-10-3-5-14(15(7-10)26(28)29)25-20(27)16-6-4-11(32-16)9-31-19-17(23)12(21)8-13(22)18(19)24/h3-8H,2,9H2,1H3,(H,25,27) |
| InChIKey | JLZLYIIMJKFKQN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.33 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|