C23H22N2O6 — CID 19448807
N-(4-ethoxy-2-nitrophenyl)-5-[(2-prop-2-enylphenoxy)methyl]furan-2-carboxamide (PubChem CID 19448807) has the molecular formula C23H22N2O6 and a molecular weight of 422.44 g/mol. Its IUPAC name is N-(4-ethoxy-2-nitrophenyl)-5-[(2-prop-2-enylphenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-(4-ethoxy-2-nitrophenyl)-5-[(2-prop-2-enylphenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19448807 |
| Molecular Formula | C23H22N2O6 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | N-(4-ethoxy-2-nitrophenyl)-5-[(2-prop-2-enylphenoxy)methyl]furan-2-carboxamide |
| SMILES | C=CCc1ccccc1OCc1ccc(C(=O)Nc2ccc(OCC)cc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C23H22N2O6/c1-3-7-16-8-5-6-9-21(16)30-15-18-11-13-22(31-18)23(26)24-19-12-10-17(29-4-2)14-20(19)25(27)28/h3,5-6,8-14H,1,4,7,15H2,2H3,(H,24,26) |
| InChIKey | VNLQTESHOFBEEQ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|