C20H16N2O7 — CID 19463925
5-(1,3-benzodioxol-5-yloxymethyl)-N-(4-methyl-2-nitrophenyl)furan-2-carboxamide (PubChem CID 19463925) has the molecular formula C20H16N2O7 and a molecular weight of 396.36 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yloxymethyl)-N-(4-methyl-2-nitrophenyl)furan-2-carboxamide.
| Compound Name | 5-(1,3-benzodioxol-5-yloxymethyl)-N-(4-methyl-2-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19463925 |
| Molecular Formula | C20H16N2O7 |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yloxymethyl)-N-(4-methyl-2-nitrophenyl)furan-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(COc3ccc4c(c3)OCO4)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H16N2O7/c1-12-2-5-15(16(8-12)22(24)25)21-20(23)18-7-4-14(29-18)10-26-13-3-6-17-19(9-13)28-11-27-17/h2-9H,10-11H2,1H3,(H,21,23) |
| InChIKey | PFDPURBAUNHEFP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 113.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|