C16H17NO6 — CID 19465699
5-(1,3-benzodioxol-5-yloxymethyl)-N-(2-methoxyethyl)furan-2-carboxamide (PubChem CID 19465699) has the molecular formula C16H17NO6 and a molecular weight of 319.31 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yloxymethyl)-N-(2-methoxyethyl)furan-2-carboxamide.
| Compound Name | 5-(1,3-benzodioxol-5-yloxymethyl)-N-(2-methoxyethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19465699 |
| Molecular Formula | C16H17NO6 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yloxymethyl)-N-(2-methoxyethyl)furan-2-carboxamide |
| SMILES | COCCNC(=O)c1ccc(COc2ccc3c(c2)OCO3)o1 |
| InChI | InChI=1S/C16H17NO6/c1-19-7-6-17-16(18)14-5-3-12(23-14)9-20-11-2-4-13-15(8-11)22-10-21-13/h2-5,8H,6-7,9-10H2,1H3,(H,17,18) |
| InChIKey | DRYLWSNFTMGVDC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 79.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|