C25H28N2O5 — CID 42753681
5-[[1,3-benzodioxol-5-ylmethyl(benzyl)amino]methyl]-N-(3-methoxypropyl)furan-2-carboxamide (PubChem CID 42753681) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is 5-[[1,3-benzodioxol-5-ylmethyl(benzyl)amino]methyl]-N-(3-methoxypropyl)furan-2-carboxamide.
| Compound Name | 5-[[1,3-benzodioxol-5-ylmethyl(benzyl)amino]methyl]-N-(3-methoxypropyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 42753681 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 5-[[1,3-benzodioxol-5-ylmethyl(benzyl)amino]methyl]-N-(3-methoxypropyl)furan-2-carboxamide |
| SMILES | COCCCNC(=O)c1ccc(CN(Cc2ccccc2)Cc2ccc3c(c2)OCO3)o1 |
| InChI | InChI=1S/C25H28N2O5/c1-29-13-5-12-26-25(28)23-11-9-21(32-23)17-27(15-19-6-3-2-4-7-19)16-20-8-10-22-24(14-20)31-18-30-22/h2-4,6-11,14H,5,12-13,15-18H2,1H3,(H,26,28) |
| InChIKey | SLWXWMHMDREJDC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 73.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|