C15H22N2O4 — CID 51200052
2-[1,3-benzodioxol-5-ylmethyl(methyl)amino]-N-(3-methoxypropyl)acetamide (PubChem CID 51200052) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is 2-[1,3-benzodioxol-5-ylmethyl(methyl)amino]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[1,3-benzodioxol-5-ylmethyl(methyl)amino]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 51200052 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 2-[1,3-benzodioxol-5-ylmethyl(methyl)amino]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CN(C)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H22N2O4/c1-17(10-15(18)16-6-3-7-19-2)9-12-4-5-13-14(8-12)21-11-20-13/h4-5,8H,3,6-7,9-11H2,1-2H3,(H,16,18) |
| InChIKey | QCWZFSXGYPUNPX-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|