C14H20N2O4 — CID 60647411
2-(1,3-benzodioxol-5-ylmethylamino)-N-(3-methoxypropyl)acetamide (PubChem CID 60647411) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethylamino)-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethylamino)-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 60647411 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethylamino)-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CNCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H20N2O4/c1-18-6-2-5-16-14(17)9-15-8-11-3-4-12-13(7-11)20-10-19-12/h3-4,7,15H,2,5-6,8-10H2,1H3,(H,16,17) |
| InChIKey | VFGRQSCVNCQCDW-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|