C19H21N3O5 — CID 109103588
5-N-(1,3-benzodioxol-5-ylmethyl)-3-N-(3-methoxypropyl)pyridine-3,5-dicarboxamide (PubChem CID 109103588) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is 5-N-(1,3-benzodioxol-5-ylmethyl)-3-N-(3-methoxypropyl)pyridine-3,5-dicarboxamide.
| Compound Name | 5-N-(1,3-benzodioxol-5-ylmethyl)-3-N-(3-methoxypropyl)pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109103588 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 5-N-(1,3-benzodioxol-5-ylmethyl)-3-N-(3-methoxypropyl)pyridine-3,5-dicarboxamide |
| SMILES | COCCCNC(=O)c1cncc(C(=O)NCc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C19H21N3O5/c1-25-6-2-5-21-18(23)14-8-15(11-20-10-14)19(24)22-9-13-3-4-16-17(7-13)27-12-26-16/h3-4,7-8,10-11H,2,5-6,9,12H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | CODQQMRZZXNPLA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|