C15H23N3O3 — CID 108995204
2-(1,3-benzodioxol-5-ylmethylamino)-N-[3-(dimethylamino)propyl]acetamide (PubChem CID 108995204) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethylamino)-N-[3-(dimethylamino)propyl]acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethylamino)-N-[3-(dimethylamino)propyl]acetamide |
|---|---|
| PubChem CID | 108995204 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethylamino)-N-[3-(dimethylamino)propyl]acetamide |
| SMILES | CN(C)CCCNC(=O)CNCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H23N3O3/c1-18(2)7-3-6-17-15(19)10-16-9-12-4-5-13-14(8-12)21-11-20-13/h4-5,8,16H,3,6-7,9-11H2,1-2H3,(H,17,19) |
| InChIKey | QPRGSEIGMVQHCV-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|