C19H22N2O3 — CID 108998701
2-(1,3-benzodioxol-5-ylmethylamino)-N-(3-phenylpropyl)acetamide (PubChem CID 108998701) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethylamino)-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethylamino)-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 108998701 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethylamino)-N-(3-phenylpropyl)acetamide |
| SMILES | O=C(CNCc1ccc2c(c1)OCO2)NCCCc1ccccc1 |
| InChI | InChI=1S/C19H22N2O3/c22-19(21-10-4-7-15-5-2-1-3-6-15)13-20-12-16-8-9-17-18(11-16)24-14-23-17/h1-3,5-6,8-9,11,20H,4,7,10,12-14H2,(H,21,22) |
| InChIKey | LSEVIPDEFCESPQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|