C12H13NO4 — CID 103249774
2-[(1,3-benzodioxol-5-ylmethylamino)methyl]prop-2-enoic acid (PubChem CID 103249774) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is 2-[(1,3-benzodioxol-5-ylmethylamino)methyl]prop-2-enoic acid.
| Compound Name | 2-[(1,3-benzodioxol-5-ylmethylamino)methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 103249774 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 2-[(1,3-benzodioxol-5-ylmethylamino)methyl]prop-2-enoic acid |
| SMILES | C=C(CNCc1ccc2c(c1)OCO2)C(=O)O |
| InChI | InChI=1S/C12H13NO4/c1-8(12(14)15)5-13-6-9-2-3-10-11(4-9)17-7-16-10/h2-4,13H,1,5-7H2,(H,14,15) |
| InChIKey | NNEAAEROEZGUMN-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|