C13H17NO4 — CID 62906802
propan-2-yl 2-(1,3-benzodioxol-5-ylmethylamino)acetate (PubChem CID 62906802) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is propan-2-yl 2-(1,3-benzodioxol-5-ylmethylamino)acetate.
| Compound Name | propan-2-yl 2-(1,3-benzodioxol-5-ylmethylamino)acetate |
|---|---|
| PubChem CID | 62906802 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | propan-2-yl 2-(1,3-benzodioxol-5-ylmethylamino)acetate |
| SMILES | CC(C)OC(=O)CNCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H17NO4/c1-9(2)18-13(15)7-14-6-10-3-4-11-12(5-10)17-8-16-11/h3-5,9,14H,6-8H2,1-2H3 |
| InChIKey | PSXPIZNSCQLSRN-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |