C16H17ClN2O4 — CID 54605734
1,2-bis(1,3-benzodioxol-5-ylmethyl)hydrazine;hydrochloride (PubChem CID 54605734) has the molecular formula C16H17ClN2O4 and a molecular weight of 336.78 g/mol. Its IUPAC name is 1,2-bis(1,3-benzodioxol-5-ylmethyl)hydrazine;hydrochloride.
| Compound Name | 1,2-bis(1,3-benzodioxol-5-ylmethyl)hydrazine;hydrochloride |
|---|---|
| PubChem CID | 54605734 |
| Molecular Formula | C16H17ClN2O4 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 1,2-bis(1,3-benzodioxol-5-ylmethyl)hydrazine;hydrochloride |
| SMILES | Cl.c1cc2c(cc1CNNCc1ccc3c(c1)OCO3)OCO2 |
| InChI | InChI=1S/C16H16N2O4.ClH/c1-3-13-15(21-9-19-13)5-11(1)7-17-18-8-12-2-4-14-16(6-12)22-10-20-14;/h1-6,17-18H,7-10H2;1H |
| InChIKey | WRXNPEBABHJSAY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|