C14H10F3NO2 — CID 62814652
N-(1,3-benzodioxol-5-ylmethyl)-2,4,5-trifluoroaniline (PubChem CID 62814652) has the molecular formula C14H10F3NO2 and a molecular weight of 281.23 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2,4,5-trifluoroaniline.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2,4,5-trifluoroaniline |
|---|---|
| PubChem CID | 62814652 |
| Molecular Formula | C14H10F3NO2 |
| Molecular Weight | 281.23 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2,4,5-trifluoroaniline |
| SMILES | Fc1cc(F)c(NCc2ccc3c(c2)OCO3)cc1F |
| InChI | InChI=1S/C14H10F3NO2/c15-9-4-11(17)12(5-10(9)16)18-6-8-1-2-13-14(3-8)20-7-19-13/h1-5,18H,6-7H2 |
| InChIKey | ZAILPOXVERUAKD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.23 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|