C15H13F2NO2 — CID 103584645
N-(1,3-benzodioxol-5-ylmethyl)-2,5-difluoro-4-methylaniline (PubChem CID 103584645) has the molecular formula C15H13F2NO2 and a molecular weight of 277.27 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2,5-difluoro-4-methylaniline.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2,5-difluoro-4-methylaniline |
|---|---|
| PubChem CID | 103584645 |
| Molecular Formula | C15H13F2NO2 |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2,5-difluoro-4-methylaniline |
| SMILES | Cc1cc(F)c(NCc2ccc3c(c2)OCO3)cc1F |
| InChI | InChI=1S/C15H13F2NO2/c1-9-4-12(17)13(6-11(9)16)18-7-10-2-3-14-15(5-10)20-8-19-14/h2-6,18H,7-8H2,1H3 |
| InChIKey | YDAZEJKPDOHONP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |