C15H13F2NO2 — CID 28614019
N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-2,5-difluoroaniline (PubChem CID 28614019) has the molecular formula C15H13F2NO2 and a molecular weight of 277.27 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-2,5-difluoroaniline.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-2,5-difluoroaniline |
|---|---|
| PubChem CID | 28614019 |
| Molecular Formula | C15H13F2NO2 |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-2,5-difluoroaniline |
| SMILES | Fc1ccc(F)c(NCc2ccc3c(c2)OCCO3)c1 |
| InChI | InChI=1S/C15H13F2NO2/c16-11-2-3-12(17)13(8-11)18-9-10-1-4-14-15(7-10)20-6-5-19-14/h1-4,7-8,18H,5-6,9H2 |
| InChIKey | FSHLVKPJBRXEPZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |