C15H13F2NO — CID 43804025
N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-2,5-difluoroaniline (PubChem CID 43804025) has the molecular formula C15H13F2NO and a molecular weight of 261.27 g/mol. Its IUPAC name is N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-2,5-difluoroaniline.
| Compound Name | N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-2,5-difluoroaniline |
|---|---|
| PubChem CID | 43804025 |
| Molecular Formula | C15H13F2NO |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-2,5-difluoroaniline |
| SMILES | Fc1ccc(F)c(NCc2ccc3c(c2)CCO3)c1 |
| InChI | InChI=1S/C15H13F2NO/c16-12-2-3-13(17)14(8-12)18-9-10-1-4-15-11(7-10)5-6-19-15/h1-4,7-8,18H,5-6,9H2 |
| InChIKey | MGCFTJNBGHRTSN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |