C15H13Cl2NO — CID 43804211
2,3-dichloro-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)aniline (PubChem CID 43804211) has the molecular formula C15H13Cl2NO and a molecular weight of 294.18 g/mol. Its IUPAC name is 2,3-dichloro-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)aniline.
| Compound Name | 2,3-dichloro-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)aniline |
|---|---|
| PubChem CID | 43804211 |
| Molecular Formula | C15H13Cl2NO |
| Molecular Weight | 294.18 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 2,3-dichloro-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)aniline |
| SMILES | Clc1cccc(NCc2ccc3c(c2)CCO3)c1Cl |
| InChI | InChI=1S/C15H13Cl2NO/c16-12-2-1-3-13(15(12)17)18-9-10-4-5-14-11(8-10)6-7-19-14/h1-5,8,18H,6-7,9H2 |
| InChIKey | HCNGMKBEHAHANX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.18 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |