C18H21NO — CID 43804020
N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-2-propan-2-ylaniline (PubChem CID 43804020) has the molecular formula C18H21NO and a molecular weight of 267.37 g/mol. Its IUPAC name is N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-2-propan-2-ylaniline.
| Compound Name | N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-2-propan-2-ylaniline |
|---|---|
| PubChem CID | 43804020 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-2-propan-2-ylaniline |
| SMILES | CC(C)c1ccccc1NCc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C18H21NO/c1-13(2)16-5-3-4-6-17(16)19-12-14-7-8-18-15(11-14)9-10-20-18/h3-8,11,13,19H,9-10,12H2,1-2H3 |
| InChIKey | VSQANTVRUUBLQN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |