C18H20N2O3 — CID 119934663
3-[2-(2,3-dihydro-1-benzofuran-5-ylmethylamino)phenoxy]propanamide (PubChem CID 119934663) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is 3-[2-(2,3-dihydro-1-benzofuran-5-ylmethylamino)phenoxy]propanamide.
| Compound Name | 3-[2-(2,3-dihydro-1-benzofuran-5-ylmethylamino)phenoxy]propanamide |
|---|---|
| PubChem CID | 119934663 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 3-[2-(2,3-dihydro-1-benzofuran-5-ylmethylamino)phenoxy]propanamide |
| SMILES | NC(=O)CCOc1ccccc1NCc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C18H20N2O3/c19-18(21)8-10-23-17-4-2-1-3-15(17)20-12-13-5-6-16-14(11-13)7-9-22-16/h1-6,11,20H,7-10,12H2,(H2,19,21) |
| InChIKey | ZAMXENVRQAQNRP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |