C16H14F3NO — CID 65447108
N-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-2,3,5-trifluoroaniline (PubChem CID 65447108) has the molecular formula C16H14F3NO and a molecular weight of 293.29 g/mol. Its IUPAC name is N-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-2,3,5-trifluoroaniline.
| Compound Name | N-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-2,3,5-trifluoroaniline |
|---|---|
| PubChem CID | 65447108 |
| Molecular Formula | C16H14F3NO |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | N-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-2,3,5-trifluoroaniline |
| SMILES | Fc1cc(F)c(F)c(NCCc2ccc3c(c2)CCO3)c1 |
| InChI | InChI=1S/C16H14F3NO/c17-12-8-13(18)16(19)14(9-12)20-5-3-10-1-2-15-11(7-10)4-6-21-15/h1-2,7-9,20H,3-6H2 |
| InChIKey | FRSZNCRBVBAHCN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|