C16H14BrF2NO — CID 102853334
5-bromo-N-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-2,4-difluoroaniline (PubChem CID 102853334) has the molecular formula C16H14BrF2NO and a molecular weight of 354.19 g/mol. Its IUPAC name is 5-bromo-N-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-2,4-difluoroaniline.
| Compound Name | 5-bromo-N-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-2,4-difluoroaniline |
|---|---|
| PubChem CID | 102853334 |
| Molecular Formula | C16H14BrF2NO |
| Molecular Weight | 354.19 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | 5-bromo-N-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-2,4-difluoroaniline |
| SMILES | Fc1cc(F)c(NCCc2ccc3c(c2)CCO3)cc1Br |
| InChI | InChI=1S/C16H14BrF2NO/c17-12-8-15(14(19)9-13(12)18)20-5-3-10-1-2-16-11(7-10)4-6-21-16/h1-2,7-9,20H,3-6H2 |
| InChIKey | URKASUPJUBSGQI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.19 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|