C15H16N2O2 — CID 115124436
2-N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)benzene-1,2-diamine (PubChem CID 115124436) has the molecular formula C15H16N2O2 and a molecular weight of 256.30 g/mol. Its IUPAC name is 2-N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)benzene-1,2-diamine.
| Compound Name | 2-N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 115124436 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 2-N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)benzene-1,2-diamine |
| SMILES | Nc1ccccc1NCc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C15H16N2O2/c16-12-3-1-2-4-13(12)17-10-11-5-6-14-15(9-11)19-8-7-18-14/h1-6,9,17H,7-8,10,16H2 |
| InChIKey | HPDKIKUUFLBCQZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|