C9H11NO2S — CID 163890520
N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)thiohydroxylamine (PubChem CID 163890520) has the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)thiohydroxylamine.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)thiohydroxylamine |
|---|---|
| PubChem CID | 163890520 |
| Molecular Formula | C9H11NO2S |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)thiohydroxylamine |
| SMILES | SNCc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C9H11NO2S/c13-10-6-7-1-2-8-9(5-7)12-4-3-11-8/h1-2,5,10,13H,3-4,6H2 |
| InChIKey | QBDHVWJPVYUMPE-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|