C10H12ClNO2 — CID 115262976
N-(chloromethyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)methanamine (PubChem CID 115262976) has the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. Its IUPAC name is N-(chloromethyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)methanamine.
| Compound Name | N-(chloromethyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)methanamine |
|---|---|
| PubChem CID | 115262976 |
| Molecular Formula | C10H12ClNO2 |
| Molecular Weight | 213.66 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | N-(chloromethyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)methanamine |
| SMILES | ClCNCc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C10H12ClNO2/c11-7-12-6-8-1-2-9-10(5-8)14-4-3-13-9/h1-2,5,12H,3-4,6-7H2 |
| InChIKey | QDONMLAKRMNVSA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.66 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|