C11H16N2O2 — CID 115225690
N'-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethyl)methanediamine (PubChem CID 115225690) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is N'-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethyl)methanediamine.
| Compound Name | N'-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethyl)methanediamine |
|---|---|
| PubChem CID | 115225690 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | N'-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethyl)methanediamine |
| SMILES | NCNCc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C11H16N2O2/c12-8-13-7-9-2-3-10-11(6-9)15-5-1-4-14-10/h2-3,6,13H,1,4-5,7-8,12H2 |
| InChIKey | KLNOLSNVNUBTRA-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|