C11H16N2O2 — CID 115226007
N'-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]methanediamine (PubChem CID 115226007) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is N'-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]methanediamine.
| Compound Name | N'-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]methanediamine |
|---|---|
| PubChem CID | 115226007 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | N'-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]methanediamine |
| SMILES | NCNCCc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C11H16N2O2/c12-8-13-4-3-9-1-2-10-11(7-9)15-6-5-14-10/h1-2,7,13H,3-6,8,12H2 |
| InChIKey | AMVJCGIHRMQXDC-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|