C10H11FO2 — CID 175038395
6-(2-fluoroethyl)-2,3-dihydro-1,4-benzodioxine (PubChem CID 175038395) has the molecular formula C10H11FO2 and a molecular weight of 182.19 g/mol. Its IUPAC name is 6-(2-fluoroethyl)-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-(2-fluoroethyl)-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 175038395 |
| Molecular Formula | C10H11FO2 |
| Molecular Weight | 182.19 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 6-(2-fluoroethyl)-2,3-dihydro-1,4-benzodioxine |
| SMILES | FCCc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C10H11FO2/c11-4-3-8-1-2-9-10(7-8)13-6-5-12-9/h1-2,7H,3-6H2 |
| InChIKey | CKVWFXYXVHMSHK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.19 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |